EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6NO4 |
| Net Charge | -1 |
| Average Mass | 144.106 |
| Monoisotopic Mass | 144.03023 |
| SMILES | NC(=O)CCC(=O)C(=O)[O-] |
| InChI | InChI=1S/C5H7NO4/c6-4(8)2-1-3(7)5(9)10/h1-2H2,(H2,6,8)(H,9,10)/p-1 |
| InChIKey | COJBGNAUUSNXHX-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxoglutaramate (CHEBI:16769) has functional parent glutaramate (CHEBI:35908) |
| 2-oxoglutaramate (CHEBI:16769) has role human metabolite (CHEBI:77746) |
| 2-oxoglutaramate (CHEBI:16769) is a 2-oxo monocarboxylic acid anion (CHEBI:35179) |
| 2-oxoglutaramate (CHEBI:16769) is conjugate base of 2-oxoglutaramic acid (CHEBI:30882) |
| Incoming Relation(s) |
| N-methyl-2-oxoglutaramate (CHEBI:17738) has functional parent 2-oxoglutaramate (CHEBI:16769) |
| 2-oxoglutaramic acid (CHEBI:30882) is conjugate acid of 2-oxoglutaramate (CHEBI:16769) |
| IUPAC Name |
|---|
| 5-amino-2,5-dioxopentanoate |
| Synonym | Source |
|---|---|
| α-ketoglutaramate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2-oxoglutaramate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00940 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:18465-19-5 | ChemIDplus |