EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H32O2 |
| Net Charge | 0 |
| Average Mass | 376.540 |
| Monoisotopic Mass | 376.24023 |
| SMILES | CC1=C(/C=C/C(=C/C=C/C(C)=C/C(=O)O)c2ccc(C)cc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C26H32O2/c1-19-11-13-23(14-12-19)22(10-6-8-20(2)18-25(27)28)15-16-24-21(3)9-7-17-26(24,4)5/h6,8,10-16,18H,7,9,17H2,1-5H3,(H,27,28)/b8-6+,16-15+,20-18+,22-10- |
| InChIKey | RQANARBNMTXCDM-DKOHIBGUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | AP-1 antagonist An antogonist that interferes with the action of activator protein 1 (AP-1). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SR11302 (CHEBI:197438) has functional parent all-trans-retinoic acid (CHEBI:15367) |
| SR11302 (CHEBI:197438) has role antineoplastic agent (CHEBI:35610) |
| SR11302 (CHEBI:197438) has role AP-1 antagonist (CHEBI:67199) |
| SR11302 (CHEBI:197438) is a retinoid (CHEBI:26537) |
| SR11302 (CHEBI:197438) is a toluenes (CHEBI:27024) |
| SR11302 (CHEBI:197438) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (2E,4E,6Z,8E)-3-methyl-7-(4-methylphenyl)-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenoic acid |
| Synonyms | Source |
|---|---|
| (2E,4E,6Z,8E)-3-methyl-7-(p-tolyl)-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenoic acid | ChEBI |
| (E,E,Z,E)-3-methyl-7-(4-methylphenyl)-9-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2,4,6,8-nonatetraenoic acid | SUBMITTER |
| SR 11302 | SUBMITTER |
| SR-11303 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:160162-42-5 | SUBMITTER |
| Citations |
|---|