EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H36NO3 |
| Net Charge | -1 |
| Average Mass | 326.501 |
| Monoisotopic Mass | 326.27007 |
| SMILES | CCCCCCCCCCCCCCCC(=O)N[C@@H](C)C(=O)[O-] |
| InChI | InChI=1S/C19H37NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18(21)20-17(2)19(22)23/h17H,3-16H2,1-2H3,(H,20,21)(H,22,23)/p-1/t17-/m0/s1 |
| InChIKey | NRBFOSKZAWRBJI-KRWDZBQOSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Drosophila melanogaster (ncbitaxon:7227) | - | PubMed (23874457) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-palmitoyl-L-alaninate (CHEBI:196953) is a N-(fatty acyl)-L-alaninate(1−) (CHEBI:176556) |
| N-palmitoyl-L-alaninate (CHEBI:196953) is a N-(fatty acyl)-L-α-amino acid anion (CHEBI:136716) |
| N-palmitoyl-L-alaninate (CHEBI:196953) is a N-acyl-L-α-amino acid anion (CHEBI:59874) |
| N-palmitoyl-L-alaninate (CHEBI:196953) is conjugate base of N-Palmitoyl alanine (CHEBI:165549) |
| Incoming Relation(s) |
| N-Palmitoyl alanine (CHEBI:165549) is conjugate acid of N-palmitoyl-L-alaninate (CHEBI:196953) |
| UniProt Name | Source |
|---|---|
| N-hexadecanoyl-L-alanine | UniProt |
| Citations |
|---|