EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H37NO3 |
| Net Charge | 0 |
| Average Mass | 327.509 |
| Monoisotopic Mass | 327.27734 |
| SMILES | CCCCCCCCCCCCCCCC(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C19H37NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18(21)20-17(2)19(22)23/h17H,3-16H2,1-2H3,(H,20,21)(H,22,23)/t17-/m0/s1 |
| InChIKey | NRBFOSKZAWRBJI-KRWDZBQOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Palmitoyl alanine (CHEBI:165549) is a N-acyl-L-amino acid (CHEBI:21644) |
| N-Palmitoyl alanine (CHEBI:165549) is conjugate acid of N-palmitoyl-L-alaninate (CHEBI:196953) |
| Incoming Relation(s) |
| N-palmitoyl-L-alaninate (CHEBI:196953) is conjugate base of N-Palmitoyl alanine (CHEBI:165549) |
| IUPAC Name |
|---|
| (2S)-2-(hexadecanoylamino)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 23283779 | ChemSpider |
| LMFA08020123 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:56255-31-3 | ChemIDplus |