EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22ClN3 |
| Net Charge | +2 |
| Average Mass | 315.848 |
| Monoisotopic Mass | 315.14913 |
| SMILES | [H][C@@]12C=C(CC[NH3+])C[C@@]([H])(C1)c1c([nH+]c3cc(Cl)ccc3c1N)C2 |
| InChI | InChI=1S/C18H20ClN3/c19-13-1-2-14-15(9-13)22-16-8-11-5-10(3-4-20)6-12(7-11)17(16)18(14)21/h1-2,5,9,11-12H,3-4,6-8,20H2,(H2,21,22)/p+2/t11-,12+/m1/s1 |
| InChIKey | NHYOUQQOKSFBKN-NEPJUHHUSA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| huprine 19(2+) (CHEBI:195563) is a primary ammonium ion (CHEBI:65296) |
| huprine 19(2+) (CHEBI:195563) is conjugate acid of huprine 19 (CHEBI:195549) |
| Incoming Relation(s) |
| huprine 19 (CHEBI:195549) is conjugate base of huprine 19(2+) (CHEBI:195563) |
| IUPAC Name |
|---|
| (7R,11R)-12-amino-9-(2-azaniumylethyl)-3-chloro-6,7,10,11-tetrahydro-7,11-methanocycloocta[b]quinolinium |
| Synonyms | Source |
|---|---|
| (7R,11R)-huprine 19(2+) | ChEBI |
| (7R,11R)-huprine 19 dication | ChEBI |
| huprine 19 dication | ChEBI |
| Citations |
|---|