EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20ClN3 |
| Net Charge | 0 |
| Average Mass | 313.832 |
| Monoisotopic Mass | 313.13458 |
| SMILES | [H][C@@]12C=C(CCN)C[C@@]([H])(C1)c1c(nc3cc(Cl)ccc3c1N)C2 |
| InChI | InChI=1S/C18H20ClN3/c19-13-1-2-14-15(9-13)22-16-8-11-5-10(3-4-20)6-12(7-11)17(16)18(14)21/h1-2,5,9,11-12H,3-4,6-8,20H2,(H2,21,22)/t11-,12+/m1/s1 |
| InChIKey | NHYOUQQOKSFBKN-NEPJUHHUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| huprine 19 (CHEBI:195549) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| huprine 19 (CHEBI:195549) is a organic heterotetracyclic compound (CHEBI:38163) |
| huprine 19 (CHEBI:195549) is a organochlorine compound (CHEBI:36683) |
| huprine 19 (CHEBI:195549) is a primary amino compound (CHEBI:50994) |
| huprine 19 (CHEBI:195549) is conjugate base of huprine 19(2+) (CHEBI:195563) |
| Incoming Relation(s) |
| huprine 19(2+) (CHEBI:195563) is conjugate acid of huprine 19 (CHEBI:195549) |
| IUPAC Name |
|---|
| (7R,11R)-9-(2-aminoethyl)-3-chloro-6,7,10,11-tetrahydro-7,11-methanocycloocta[b]quinolin-12-amine |
| Synonyms | Source |
|---|---|
| (7R,11R)-huprine 19 | ChEBI |
| huprine-19 | ChEBI |
| huprine19 | ChEBI |
| Citations |
|---|