EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O18P4 |
| Net Charge | -8 |
| Average Mass | 492.008 |
| Monoisotopic Mass | 491.87050 |
| SMILES | O=P([O-])([O-])O[C@H]1[C@H](OP(=O)([O-])[O-])[C@@H](OP(=O)([O-])[O-])[C@H](O)[C@@H](O)[C@H]1OP(=O)([O-])[O-] |
| InChI | InChI=1S/C6H16O18P4/c7-1-2(8)4(22-26(12,13)14)6(24-28(18,19)20)5(23-27(15,16)17)3(1)21-25(9,10)11/h1-8H,(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20)/p-8/t1-,2-,3-,4+,5-,6-/m1/s1 |
| InChIKey | MRVYFOANPDTYBY-XCMZKKERSA-F |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1D-myo-inositol 1,2,5,6-tetrakisphosphate(8−) (CHEBI:195535) is a inositol phosphate oxoanion (CHEBI:76301) |
| 1D-myo-inositol 1,2,5,6-tetrakisphosphate(8−) (CHEBI:195535) is conjugate base of 1D-myo-inositol 1,2,5,6-tetrakisphosphate (CHEBI:133328) |
| Incoming Relation(s) |
| 1D-myo-inositol 1,2,5,6-tetrakisphosphate (CHEBI:133328) is conjugate acid of 1D-myo-inositol 1,2,5,6-tetrakisphosphate(8−) (CHEBI:195535) |
| UniProt Name | Source |
|---|---|
| 1D-myo-inositol 1,2,5,6-tetrakisphosphate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-6742 | MetaCyc |
| Citations |
|---|