EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H16O18P4 |
| Net Charge | 0 |
| Average Mass | 500.072 |
| Monoisotopic Mass | 499.92871 |
| SMILES | O=P(O)(O)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@H]1OP(=O)(O)O |
| InChI | InChI=1S/C6H16O18P4/c7-1-2(8)4(22-26(12,13)14)6(24-28(18,19)20)5(23-27(15,16)17)3(1)21-25(9,10)11/h1-8H,(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20)/t1-,2-,3-,4+,5-,6-/m1/s1 |
| InChIKey | MRVYFOANPDTYBY-XCMZKKERSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycine max (ncbitaxon:3847) | |||
| - | PubMed (25369450) | ||
| - | MetaboLights (MTBLS118) | ||
| - | MetaboLights (MTBLS117) | ||
| Hordeum vulgare (ncbitaxon:4513) | seed (BTO:0001226) | PubMed (24967651) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1D-myo-inositol 1,2,5,6-tetrakisphosphate (CHEBI:133328) has functional parent myo-inositol (CHEBI:17268) |
| 1D-myo-inositol 1,2,5,6-tetrakisphosphate (CHEBI:133328) has role plant metabolite (CHEBI:76924) |
| 1D-myo-inositol 1,2,5,6-tetrakisphosphate (CHEBI:133328) is a myo-inositol tetrakisphosphate (CHEBI:25449) |
| 1D-myo-inositol 1,2,5,6-tetrakisphosphate (CHEBI:133328) is conjugate acid of 1D-myo-inositol 1,2,5,6-tetrakisphosphate(8−) (CHEBI:195535) |
| Incoming Relation(s) |
| 1D-myo-inositol 1,2,5,6-tetrakisphosphate(8−) (CHEBI:195535) is conjugate base of 1D-myo-inositol 1,2,5,6-tetrakisphosphate (CHEBI:133328) |
| IUPAC Names |
|---|
| (1R,2R,3R,4S,5R,6R)-5,6-dihydroxycyclohexane-1,2,3,4-tetrayl tetrakis[dihydrogen (phosphate)] |
| 1D-myo-inositol 1,2,5,6-tetrakis(dihydrogen phosphate) |
| Synonyms | Source |
|---|---|
| Ins(1,2,5,6)P4 | MetaCyc |
| D-myo-inositol 1,2,5,6-tetrakisphosphate | ChEBI |
| D-myo-inositol (1,2,5,6) tetrakisphosphate | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7755312 | Reaxys |
| Citations |
|---|