EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H42N2O2 |
| Net Charge | +2 |
| Average Mass | 366.590 |
| Monoisotopic Mass | 366.32353 |
| SMILES | CC1CCC2C3(C)OC4(C)CC(O)C12CC4C3[NH2+]CCCCC[NH+](C)C |
| InChI | InChI=1S/C22H40N2O2/c1-15-9-10-17-21(3)19(23-11-7-6-8-12-24(4)5)16-13-22(15,17)18(25)14-20(16,2)26-21/h15-19,23,25H,6-14H2,1-5H3/p+2 |
| InChIKey | WOPTWQVXPWEBSB-UHFFFAOYSA-P |
| Roles Classification |
|---|
| Chemical Role: | polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. |
| Application: | polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-hydroxy-pre-flavunoidine (CHEBI:195495) has functional parent pre-flavunoidine(2+) (CHEBI:194090) |
| 10-hydroxy-pre-flavunoidine (CHEBI:195495) is a oxolane (CHEBI:26911) |
| UniProt Name | Source |
|---|---|
| 10-hydroxy-pre-flavunoidine | UniProt |
| Citations |
|---|