EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H42N2O |
| Net Charge | +2 |
| Average Mass | 350.591 |
| Monoisotopic Mass | 350.32862 |
| SMILES | CC1CCC2C13CCC1(C)OC2(C)C([NH2+]CCCCC[NH+](C)C)C1C3 |
| InChI | InChI=1S/C22H40N2O/c1-16-9-10-18-21(3)19(23-13-7-6-8-14-24(4)5)17-15-22(16,18)12-11-20(17,2)25-21/h16-19,23H,6-15H2,1-5H3/p+2 |
| InChIKey | YLLLLBHEAHDXCP-UHFFFAOYSA-P |
| Roles Classification |
|---|
| Chemical Role: | polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. |
| Application: | polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pre-flavunoidine(2+) (CHEBI:194090) is a oxolane (CHEBI:26911) |
| Incoming Relation(s) |
| 10-hydroxy-pre-flavunoidine (CHEBI:195495) has functional parent pre-flavunoidine(2+) (CHEBI:194090) |
| UniProt Name | Source |
|---|---|
| pre-flavunoidine | UniProt |
| Citations |
|---|