EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H9NO |
| Net Charge | 0 |
| Average Mass | 75.111 |
| Monoisotopic Mass | 75.06841 |
| SMILES | C[C@@H](N)CO |
| InChI | InChI=1S/C3H9NO/c1-3(4)2-5/h3,5H,2,4H2,1H3/t3-/m1/s1 |
| InChIKey | BKMMTJMQCTUHRP-GSVOUGTGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-2-aminopropan-1-ol (CHEBI:195478) is a 2-aminopropan-1-ol (CHEBI:195477) |
| (R)-2-aminopropan-1-ol (CHEBI:195478) is enantiomer of (S)-2-aminopropan-1-ol (CHEBI:78502) |
| Incoming Relation(s) |
| (S)-2-aminopropan-1-ol (CHEBI:78502) is enantiomer of (R)-2-aminopropan-1-ol (CHEBI:195478) |
| IUPAC Name |
|---|
| (2R)-2-aminopropan-1-ol |
| Synonyms | Source |
|---|---|
| D-alaninol | ChEBI |
| (R)-(−)-2-amino-1-propanol | ChEBI |
| H-D-Ala-ol | ChEBI |
| (2R)-2-azanylpropan-1-ol | PDBeChem |
| (−)-2-amino-1-propanol | ChEBI |
| (−)-alaninol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2A3 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1718866 | Reaxys |
| CAS:35320-23-1 | ChEBI |
| Citations |
|---|