EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H9NO |
| Net Charge | 0 |
| Average Mass | 75.111 |
| Monoisotopic Mass | 75.06841 |
| SMILES | CC(N)CO |
| InChI | InChI=1S/C3H9NO/c1-3(4)2-5/h3,5H,2,4H2,1H3 |
| InChIKey | BKMMTJMQCTUHRP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-aminopropan-1-ol (CHEBI:195477) is a amino alcohol (CHEBI:22478) |
| 2-aminopropan-1-ol (CHEBI:195477) is a primary alcohol (CHEBI:15734) |
| 2-aminopropan-1-ol (CHEBI:195477) is a primary amino compound (CHEBI:50994) |
| 2-aminopropan-1-ol (CHEBI:195477) is conjugate base of 2-aminopropan-1-ol(1+) (CHEBI:195439) |
| Incoming Relation(s) |
| (R)-2-aminopropan-1-ol (CHEBI:195478) is a 2-aminopropan-1-ol (CHEBI:195477) |
| (S)-2-aminopropan-1-ol (CHEBI:78502) is a 2-aminopropan-1-ol (CHEBI:195477) |
| 2-aminopropan-1-ol(1+) (CHEBI:195439) is conjugate acid of 2-aminopropan-1-ol (CHEBI:195477) |
| IUPAC Name |
|---|
| 2-aminopropan-1-ol |
| Synonyms | Source |
|---|---|
| 2-amino-1-propanol | ChEBI |
| 2-aminopropanol | ChEBI |
| β-propanolamine | ChEBI |
| 2-amino-2-methylethanol | ChEBI |
| 1-hydroxy-2-aminopropane | ChEBI |
| 2-hydroxy-1-methylethylamine | ChEBI |
| Citations |
|---|