EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:195298 - loganetin
| Formula | C11H16O5 |
| Net Charge | 0 |
| Average Mass | 228.244 |
| Monoisotopic Mass | 228.09977 |
| SMILES | [H][C@]12[C@H](O)OC=C(C(=O)OC)[C@@]1([H])C[C@H](O)[C@@H]2C |
| InChI | InChI=1S/C11H16O5/c1-5-8(12)3-6-7(10(13)15-2)4-16-11(14)9(5)6/h4-6,8-9,11-12,14H,3H2,1-2H3/t5-,6+,8-,9+,11+/m0/s1 |
| InChIKey | XWOHZIIPBYAMJX-KHBMLBSESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scaevola floribunda (ncbitaxon:197961) | heartwood (PO:0004512) | DOI (10.1021/NP9702852) | |
| Desfontainia spinosa (ncbitaxon:34247) | leaf (BTO:0000713) | DOI (10.1016/S0031-9422(00)82565-0) | |
| Lonicera fragrantissima (ncbitaxon:486666) | flower (BTO:0000469) | PubMed (19967996) | |
| Nauclea orientalis (ncbitaxon:43526) | stem (BTO:0001300) | PubMed (26749820) | |
| Strychnos nux-blanda (ncbitaxon:1037791) | Root (BTO:0001188) | PubMed (27534097) | |
| Neonauclea reticulata (ncbitaxon:2755438) | stem (BTO:0001300) | PubMed (30205569) | |
| Calycophyllum spruceanum (ncbitaxon:271242) | bark (BTO:0001301) | PubMed (12943773) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| loganetin (CHEBI:195298) has role antibacterial agent (CHEBI:33282) |
| loganetin (CHEBI:195298) has role plant metabolite (CHEBI:76924) |
| loganetin (CHEBI:195298) is a cyclopentapyran (CHEBI:38606) |
| loganetin (CHEBI:195298) is a enoate ester (CHEBI:51702) |
| loganetin (CHEBI:195298) is a iridoid monoterpenoid (CHEBI:50563) |
| loganetin (CHEBI:195298) is a lactol (CHEBI:38131) |
| loganetin (CHEBI:195298) is a methyl ester (CHEBI:25248) |
| loganetin (CHEBI:195298) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| loganin (CHEBI:15771) has functional parent loganetin (CHEBI:195298) |
| IUPAC Name |
|---|
| methyl (1R,4aS,6S,7R,7aS)-1,6-dihydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
| UniProt Name | Source |
|---|---|
| loganetin | UniProt |
| Citations |
|---|