EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26O10 |
| Net Charge | 0 |
| Average Mass | 390.385 |
| Monoisotopic Mass | 390.15260 |
| SMILES | [H][C@]12[C@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)OC=C(C(=O)OC)[C@@]1([H])C[C@H](O)[C@@H]2C |
| InChI | InChI=1S/C17H26O10/c1-6-9(19)3-7-8(15(23)24-2)5-25-16(11(6)7)27-17-14(22)13(21)12(20)10(4-18)26-17/h5-7,9-14,16-22H,3-4H2,1-2H3/t6-,7+,9-,10+,11+,12+,13-,14+,16-,17-/m0/s1 |
| InChIKey | AMBQHHVBBHTQBF-UOUCRYGSSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Strychnos nux-blanda (ncbitaxon:1037791) | root (BTO:0001188) | PubMed (27534097) | |
| Strychnos nux-vomica (ncbitaxon:28545) | - | PubMed (19666019) | |
| Uncaria cordata (ncbitaxon:1382054) | - | PubMed (27128898) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 3.4.23.46 (memapsin 2) inhibitor An EC 3.4.23.* (aspartic endopeptidase) inhibitor that interferes with the activity of memapsin 2 (EC 3.4.23.46). EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| loganin (CHEBI:15771) has functional parent loganetin (CHEBI:195298) |
| loganin (CHEBI:15771) has role anti-inflammatory agent (CHEBI:67079) |
| loganin (CHEBI:15771) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| loganin (CHEBI:15771) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| loganin (CHEBI:15771) has role EC 3.4.23.46 (memapsin 2) inhibitor (CHEBI:74925) |
| loganin (CHEBI:15771) has role neuroprotective agent (CHEBI:63726) |
| loganin (CHEBI:15771) has role plant metabolite (CHEBI:76924) |
| loganin (CHEBI:15771) is a cyclopentapyran (CHEBI:38606) |
| loganin (CHEBI:15771) is a enoate ester (CHEBI:51702) |
| loganin (CHEBI:15771) is a iridoid monoterpenoid (CHEBI:50563) |
| loganin (CHEBI:15771) is a methyl ester (CHEBI:25248) |
| loganin (CHEBI:15771) is a monosaccharide derivative (CHEBI:63367) |
| loganin (CHEBI:15771) is a secondary alcohol (CHEBI:35681) |
| loganin (CHEBI:15771) is a β-D-glucoside (CHEBI:22798) |
| Incoming Relation(s) |
| 7-deoxyloganin (CHEBI:18370) has functional parent loganin (CHEBI:15771) |
| IUPAC Name |
|---|
| methyl (1S,4aS,6S,7R,7aS)-1-(β-D-glucopyranosyloxy)-6-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
| Synonyms | Source |
|---|---|
| 1-(beta-D-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-6-hydroxy-7-methylcyclopenta[c]pyran-4-carboxylic acid methyl ester | ChEBI |
| Loganin | KEGG COMPOUND |
| loganoside | ChEBI |
| UniProt Name | Source |
|---|---|
| loganin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:55724 | Reaxys |
| CAS:18524-94-2 | ChemIDplus |
| CAS:18524-94-2 | KEGG COMPOUND |
| Citations |
|---|