EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26O10 |
| Net Charge | 0 |
| Average Mass | 390.385 |
| Monoisotopic Mass | 390.15260 |
| SMILES | [H][C@]12[C@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)OC=C(C(=O)OC)[C@@]1([H])C[C@H](O)[C@@H]2C |
| InChI | InChI=1S/C17H26O10/c1-6-9(19)3-7-8(15(23)24-2)5-25-16(11(6)7)27-17-14(22)13(21)12(20)10(4-18)26-17/h5-7,9-14,16-22H,3-4H2,1-2H3/t6-,7+,9-,10+,11+,12+,13-,14+,16-,17-/m0/s1 |
| InChIKey | AMBQHHVBBHTQBF-UOUCRYGSSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Strychnos nux-blanda (ncbitaxon:1037791) | root (BTO:0001188) | PubMed (27534097) | |
| Strychnos nux-vomica (ncbitaxon:28545) | - | PubMed (19666019) | |
| Uncaria cordata (ncbitaxon:1382054) | - | PubMed (27128898) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. EC 3.4.23.46 (memapsin 2) inhibitor An EC 3.4.23.* (aspartic endopeptidase) inhibitor that interferes with the activity of memapsin 2 (EC 3.4.23.46). EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| loganin (CHEBI:15771) has functional parent loganetin (CHEBI:195298) |
| loganin (CHEBI:15771) has role anti-inflammatory agent (CHEBI:67079) |
| loganin (CHEBI:15771) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| loganin (CHEBI:15771) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| loganin (CHEBI:15771) has role EC 3.4.23.46 (memapsin 2) inhibitor (CHEBI:74925) |
| loganin (CHEBI:15771) has role neuroprotective agent (CHEBI:63726) |
| loganin (CHEBI:15771) has role plant metabolite (CHEBI:76924) |
| loganin (CHEBI:15771) is a cyclopentapyran (CHEBI:38606) |
| loganin (CHEBI:15771) is a enoate ester (CHEBI:51702) |
| loganin (CHEBI:15771) is a iridoid monoterpenoid (CHEBI:50563) |
| loganin (CHEBI:15771) is a methyl ester (CHEBI:25248) |
| loganin (CHEBI:15771) is a monosaccharide derivative (CHEBI:63367) |
| loganin (CHEBI:15771) is a secondary alcohol (CHEBI:35681) |
| loganin (CHEBI:15771) is a β-D-glucoside (CHEBI:22798) |
| Incoming Relation(s) |
| 7-deoxyloganin (CHEBI:18370) has functional parent loganin (CHEBI:15771) |
| IUPAC Name |
|---|
| methyl (1S,4aS,6S,7R,7aS)-1-(β-D-glucopyranosyloxy)-6-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
| Synonyms | Source |
|---|---|
| 1-(beta-D-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-6-hydroxy-7-methylcyclopenta[c]pyran-4-carboxylic acid methyl ester | ChEBI |
| Loganin | KEGG COMPOUND |
| loganoside | ChEBI |
| UniProt Name | Source |
|---|---|
| loganin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:55724 | Reaxys |
| CAS:18524-94-2 | ChemIDplus |
| CAS:18524-94-2 | KEGG COMPOUND |
| Citations |
|---|