EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26O5 |
| Net Charge | 0 |
| Average Mass | 298.379 |
| Monoisotopic Mass | 298.17802 |
| SMILES | [H][C@]12O[C@H](OC)[C@H](C)[C@]3([H])CC[C@@H](C)[C@]4([H])CC[C@@](C)(OO[C@]143)O2 |
| InChI | InChI=1S/C16H26O5/c1-9-5-6-12-10(2)13(17-4)18-14-16(12)11(9)7-8-15(3,19-14)20-21-16/h9-14H,5-8H2,1-4H3/t9-,10-,11+,12+,13+,14-,15-,16-/m1/s1 |
| InChIKey | SXYIRMFQILZOAM-HVNFFKDJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Applications: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| artemether (CHEBI:195280) has role anti-HIV agent (CHEBI:64946) |
| artemether (CHEBI:195280) has role antimalarial (CHEBI:38068) |
| artemether (CHEBI:195280) has role antineoplastic agent (CHEBI:35610) |
| artemether (CHEBI:195280) is a artemisinin derivative (CHEBI:63920) |
| artemether (CHEBI:195280) is a cyclic acetal (CHEBI:59770) |
| artemether (CHEBI:195280) is a organic peroxide (CHEBI:25702) |
| artemether (CHEBI:195280) is a semisynthetic derivative (CHEBI:72588) |
| artemether (CHEBI:195280) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (3R,5aS,6R,8aS,9R,10S,12R,12aR)-10-methoxy-3,6,9-trimethyldecahydro-3,12-epoxypyrano[4,3-j][1,2]benzodioxepine |
| INNs | Source |
|---|---|
| artemetero | ChemIDplus |
| artemether | KEGG DRUG |
| artemetherum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 10-methoxy-1,5,9-trimethyl-(1R,4S,5R,8S,9R,10S,12R,13R)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane | ChEMBL |
| (1R,4S,5R,8S,9R,10S,12R,13R)-10-methoxy-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.0^{4,13}.0^{8,13}]hexadecane | ChEBI |
| artemisininelactol methyl ether | ChemIDplus |
| ATM | ChEBI |
| .beta.-artemether | ChEMBL |
| Dihydroartemisinin impurity g | ChEMBL |
| Brand Names | Source |
|---|---|
| Artemether component of coartem | ChEMBL |
| Artemetheri | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 245 | DrugCentral |
| Artemether | Wikipedia |
| D02483 | KEGG DRUG |
| DB06697 | DrugBank |
| LSM-5519 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6569878 | Beilstein |
| CAS:71963-77-4 | ChemIDplus |
| CAS:71963-77-4 | KEGG DRUG |
| Citations |
|---|