EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26O5 |
| Net Charge | 0 |
| Average Mass | 298.379 |
| Monoisotopic Mass | 298.17802 |
| SMILES | [H][C@]12O[C@H](OC)[C@H](C)[C@]3([H])CC[C@@H](C)[C@]4([H])CC[C@@](C)(OO[C@]143)O2 |
| InChI | InChI=1S/C16H26O5/c1-9-5-6-12-10(2)13(17-4)18-14-16(12)11(9)7-8-15(3,19-14)20-21-16/h9-14H,5-8H2,1-4H3/t9-,10-,11+,12+,13+,14-,15-,16-/m1/s1 |
| InChIKey | SXYIRMFQILZOAM-HVNFFKDJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| Biological Role: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| artemether (CHEBI:195280) has role antimalarial (CHEBI:38068) |
| artemether (CHEBI:195280) is a artemisinin derivative (CHEBI:63920) |
| artemether (CHEBI:195280) is a cyclic acetal (CHEBI:59770) |
| artemether (CHEBI:195280) is a organic peroxide (CHEBI:25702) |
| artemether (CHEBI:195280) is a semisynthetic derivative (CHEBI:72588) |
| artemether (CHEBI:195280) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (3R,5aS,6R,8aS,9R,10S,12R,12aR)-10-methoxy-3,6,9-trimethyldecahydro-3,12-epoxypyrano[4,3-j][1,2]benzodioxepine |
| INNs | Source |
|---|---|
| artemether | KEGG DRUG |
| artemetero | ChemIDplus |
| artemetherum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 10-methoxy-1,5,9-trimethyl-(1R,4S,5R,8S,9R,10S,12R,13R)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane | ChEMBL |
| artemisininelactol methyl ether | ChemIDplus |
| dihydroartemisinin methyl ether | ChemIDplus |
| methyl-dihydroartemisinine | ChemIDplus |
| β-artemether | ChemIDplus |
| β-dihydroartemisinin methyl ether | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D02483 | KEGG DRUG |
| Artemether | Wikipedia |
| DB06697 | DrugBank |
| LSM-5519 | LINCS |
| 245 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6569878 | Beilstein |
| CAS:71963-77-4 | KEGG DRUG |
| CAS:71963-77-4 | ChemIDplus |
| Citations |
|---|