EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7NO3 |
| Net Charge | 0 |
| Average Mass | 165.148 |
| Monoisotopic Mass | 165.04259 |
| SMILES | COc1ccc2nc(=O)oc2c1 |
| InChI | InChI=1S/C8H7NO3/c1-11-5-2-3-6-7(4-5)12-8(10)9-6/h2-4H,1H3,(H,9,10) |
| InChIKey | MKMCJLMBVKHUMS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-methoxy-2-benzoxazolinone (CHEBI:195240) has functional parent 2-benzoxazolinone (CHEBI:145233) |
| 6-methoxy-2-benzoxazolinone (CHEBI:195240) has role antibacterial agent (CHEBI:33282) |
| 6-methoxy-2-benzoxazolinone (CHEBI:195240) has role anticonvulsant (CHEBI:35623) |
| 6-methoxy-2-benzoxazolinone (CHEBI:195240) has role antifungal agent (CHEBI:35718) |
| 6-methoxy-2-benzoxazolinone (CHEBI:195240) has role muscle relaxant (CHEBI:51371) |
| 6-methoxy-2-benzoxazolinone (CHEBI:195240) has role plant metabolite (CHEBI:76924) |
| 6-methoxy-2-benzoxazolinone (CHEBI:195240) is a aromatic ether (CHEBI:35618) |
| 6-methoxy-2-benzoxazolinone (CHEBI:195240) is a benzoxazole (CHEBI:46700) |
| IUPAC Name |
|---|
| 6-methoxy-1,3-benzoxazol-2(3H)-one |
| Synonyms | Source |
|---|---|
| 6-MBOA | ChEBI |
| 6-methoxy-3H-benzoxazol-2-one | ChEBI |
| 6-methoxybenzo[d]oxazol-2(3H)-one | ChEBI |
| 6-methoxybenzoxazolin-2(3H)-one | ChEBI |
| 6-methoxybenzoxazolinone | ChEBI |
| MBOA | ChEBI |
| Brand Name | Source |
|---|---|
| Coixol | ChEBI |
| UniProt Name | Source |
|---|---|
| 6-methoxy-2-benzoxazolinone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 10317 | ChemSpider |
| C00036627 | KNApSAcK |
| FDB015492 | FooDB |
| HMDB0036582 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:532-91-2 | NIST Chemistry WebBook |
| Citations |
|---|