EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7ClO5 |
| Net Charge | 0 |
| Average Mass | 194.570 |
| Monoisotopic Mass | 193.99820 |
| SMILES | O=C(O)CCC(=O)C(Cl)C(=O)O |
| InChI | InChI=1S/C6H7ClO5/c7-5(6(11)12)3(8)1-2-4(9)10/h5H,1-2H2,(H,9,10)(H,11,12) |
| InChIKey | YJYHEBUTQYISNJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas sp. (ncbitaxon:306) | - | PubMed (16348484) | Strain: PS12 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-chloro-3-oxoadipic acid (CHEBI:19500) has functional parent adipic acid (CHEBI:30832) |
| 2-chloro-3-oxoadipic acid (CHEBI:19500) has role bacterial metabolite (CHEBI:76969) |
| 2-chloro-3-oxoadipic acid (CHEBI:19500) is a organochlorine compound (CHEBI:36683) |
| 2-chloro-3-oxoadipic acid (CHEBI:19500) is a oxo dicarboxylic acid (CHEBI:36145) |
| 2-chloro-3-oxoadipic acid (CHEBI:19500) is conjugate acid of 2-chloro-3-oxoadipate (CHEBI:149587) |
| Incoming Relation(s) |
| 2-chloro-3-oxoadipate (CHEBI:149587) is conjugate base of 2-chloro-3-oxoadipic acid (CHEBI:19500) |
| IUPAC Name |
|---|
| 2-chloro-3-oxohexanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| C12836 | KEGG COMPOUND |
| Citations |
|---|