EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5ClO5 |
| Net Charge | -2 |
| Average Mass | 192.554 |
| Monoisotopic Mass | 191.98365 |
| SMILES | O=C([O-])CCC(=O)C(Cl)C(=O)[O-] |
| InChI | InChI=1S/C6H7ClO5/c7-5(6(11)12)3(8)1-2-4(9)10/h5H,1-2H2,(H,9,10)(H,11,12)/p-2 |
| InChIKey | YJYHEBUTQYISNJ-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-chloro-3-oxoadipate (CHEBI:149587) is a oxo dicarboxylic acid dianion (CHEBI:133294) |
| 2-chloro-3-oxoadipate (CHEBI:149587) is conjugate base of 2-chloro-3-oxoadipic acid (CHEBI:19500) |
| Incoming Relation(s) |
| 2-chloro-3-oxoadipic acid (CHEBI:19500) is conjugate acid of 2-chloro-3-oxoadipate (CHEBI:149587) |
| IUPAC Name |
|---|
| 2-chloro-3-oxohexanedioate |
| Synonym | Source |
|---|---|
| 2-chloro-3-keto-adipate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| c0490 | UM-BBD |
| Citations |
|---|