EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10O3 |
| Net Charge | 0 |
| Average Mass | 202.209 |
| Monoisotopic Mass | 202.06299 |
| SMILES | Cc1oc(-c2ccccc2)cc1C(=O)O |
| InChI | InChI=1S/C12H10O3/c1-8-10(12(13)14)7-11(15-8)9-5-3-2-4-6-9/h2-7H,1H3,(H,13,14) |
| InChIKey | VLMNACSEESRUAK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Methyl-5-phenyl-3-furoic acid (CHEBI:194898) is a furoic acid (CHEBI:36055) |
| IUPAC Name |
|---|
| 2-methyl-5-phenyluran-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 643637 | ChemSpider |