EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H9ClF2N4O2 |
| Net Charge | 0 |
| Average Mass | 362.723 |
| Monoisotopic Mass | 362.03821 |
| SMILES | N#CCOC(=O)c1nc(-c2ccc3ccnc3c2F)c(F)c(N)c1Cl |
| InChI | InChI=1S/C16H9ClF2N4O2/c17-9-12(21)11(19)14(23-15(9)16(24)25-6-4-20)8-2-1-7-3-5-22-13(7)10(8)18/h1-3,5,22H,6H2,(H2,21,23) |
| InChIKey | OVIZXYUPMXRUSD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indolauxipyr-cyanomethyl (CHEBI:194526) has functional parent indolauxipyr (CHEBI:194525) |
| indolauxipyr-cyanomethyl (CHEBI:194526) has role herbicide (CHEBI:24527) |
| indolauxipyr-cyanomethyl (CHEBI:194526) is a aminopyridine (CHEBI:38207) |
| indolauxipyr-cyanomethyl (CHEBI:194526) is a carboxylic ester (CHEBI:33308) |
| indolauxipyr-cyanomethyl (CHEBI:194526) is a chloropyridine (CHEBI:39173) |
| indolauxipyr-cyanomethyl (CHEBI:194526) is a fluoroindole (CHEBI:131960) |
| indolauxipyr-cyanomethyl (CHEBI:194526) is a nitrile (CHEBI:18379) |
| IUPAC Name |
|---|
| cyanomethyl 4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylate |
| Synonyms | Source |
|---|---|
| cyanomethyl 4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)-2-pyridinecarboxylate | Alan Wood's Pesticides |
| cyanomethyl 4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)picolinate | Alan Wood's Pesticides |
| XDE-521 | ChEBI |
| XR-521 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3553 | PPDB |
| derivatives/indolauxipyr-cyanomethyl | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:2251111-18-7 | Alan Wood's Pesticides |