EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8ClF2N3O2 |
| Net Charge | 0 |
| Average Mass | 323.686 |
| Monoisotopic Mass | 323.02731 |
| SMILES | Nc1c(F)c(-c2ccc3ccnc3c2F)nc(C(=O)O)c1Cl |
| InChI | InChI=1S/C14H8ClF2N3O2/c15-7-10(18)9(17)12(20-13(7)14(21)22)6-2-1-5-3-4-19-11(5)8(6)16/h1-4,19H,(H2,18,20)(H,21,22) |
| InChIKey | CIPJEXPBJDLNIP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indolauxipyr (CHEBI:194525) has role herbicide (CHEBI:24527) |
| indolauxipyr (CHEBI:194525) is a aminopyridine (CHEBI:38207) |
| indolauxipyr (CHEBI:194525) is a chloropyridine (CHEBI:39173) |
| indolauxipyr (CHEBI:194525) is a fluoroindole (CHEBI:131960) |
| indolauxipyr (CHEBI:194525) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Incoming Relation(s) |
| indolauxipyr-cyanomethyl (CHEBI:194526) has functional parent indolauxipyr (CHEBI:194525) |
| IUPAC Name |
|---|
| 4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)-2-pyridinecarboxylic acid | Alan Wood's Pesticides |
| 4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)picolinic acid | Alan Wood's Pesticides |
| X12312263 | ChEBI |
| X-263 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3552 | PPDB |
| indolauxipyr | Alan Wood's Pesticides |
| WO2014151005 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:1628702-28-2 | Alan Wood's Pesticides |