EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12O2 |
| Net Charge | 0 |
| Average Mass | 140.182 |
| Monoisotopic Mass | 140.08373 |
| SMILES | C/C=C/C=C/COC(C)=O |
| InChI | InChI=1S/C8H12O2/c1-3-4-5-6-7-10-8(2)9/h3-6H,7H2,1-2H3/b4-3+,6-5+ |
| InChIKey | PXVKYPFROMBALG-VNKDHWASSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lygaeus equestris (ncbitaxon:696229) | - | PubMed (32080314) |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E,E)-2,4-hexadienyl acetate (CHEBI:194509) has functional parent (2E,4E)-2,4-hexadien-1-ol (CHEBI:142625) |
| (E,E)-2,4-hexadienyl acetate (CHEBI:194509) has role animal metabolite (CHEBI:75767) |
| (E,E)-2,4-hexadienyl acetate (CHEBI:194509) has role pheromone (CHEBI:26013) |
| (E,E)-2,4-hexadienyl acetate (CHEBI:194509) is a 2,4-hexadienyl acetate (CHEBI:191490) |
| IUPAC Name |
|---|
| (2E,4E)-hexa-2,4-dien-1-yl acetate |
| Synonyms | Source |
|---|---|
| (2E,4E)-2,4-hexadien-1-yl acetate | ChEBI |
| 1-acetoxy-(E,E)-2,4-hexadiene | ChEBI |
| (E,E)-2,4-hexadienyl acetate | ChEBI |
| (2E,4E)-2,4-hexadienyl acetate | ChEBI |
| (E,E)-2,4-hexadien-1-ol acetate | ChEBI |
| (2E,4E)-2,4-hexadien-1-ol 1-acetate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA07010180 | LIPID MAPS |
| 4515830 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:57006-69-6 | PubChem Compound |
| Citations |
|---|