EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12O2 |
| Net Charge | 0 |
| Average Mass | 140.182 |
| Monoisotopic Mass | 140.08373 |
| SMILES | [H]C(C)=CC([H])=CCOC(C)=O |
| InChI | InChI=1S/C8H12O2/c1-3-4-5-6-7-10-8(2)9/h3-6H,7H2,1-2H3 |
| InChIKey | PXVKYPFROMBALG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum tuberosum (ncbitaxon:4113) | leaf (BTO:0000713) | MetaboLights (MTBLS4365) |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-hexadienyl acetate (CHEBI:191490) has role flavouring agent (CHEBI:35617) |
| 2,4-hexadienyl acetate (CHEBI:191490) has role plant metabolite (CHEBI:76924) |
| 2,4-hexadienyl acetate (CHEBI:191490) is a acetate ester (CHEBI:47622) |
| 2,4-hexadienyl acetate (CHEBI:191490) is a olefinic compound (CHEBI:78840) |
| Incoming Relation(s) |
| (E,E)-2,4-hexadienyl acetate (CHEBI:194509) is a 2,4-hexadienyl acetate (CHEBI:191490) |
| IUPAC Name |
|---|
| hexa-2,4-dien-1-yl acetate |
| Synonyms | Source |
|---|---|
| 1-acetoxy-2,4-hexadiene | ChEBI |
| 2,4-hexadien-1-ol 1-acetate | ChEBI |
| 2,4-hexadien-1-ol, 1-acetate | ChEBI |
| 2,4-hexadien-1-ol acetate | ChEBI |
| 2,4-hexadien-1-ol, acetate | ChEBI |
| 2,4-hexadien-1-yl acetate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 14462 | ChemSpider |
| HMDB0032311 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1516-17-2 | PubChem Compound |