EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H20N2O6S |
| Net Charge | 0 |
| Average Mass | 464.499 |
| Monoisotopic Mass | 464.10421 |
| SMILES | [H][C@]12SC(C)(C)C(C(=O)O)N1C(=O)[C@H]2NC(=O)c1cccc(-c2cc(=O)c3ccccc3o2)c1 |
| InChI | InChI=1S/C24H20N2O6S/c1-24(2)19(23(30)31)26-21(29)18(22(26)33-24)25-20(28)13-7-5-6-12(10-13)17-11-15(27)14-8-3-4-9-16(14)32-17/h3-11,18-19,22H,1-2H3,(H,25,28)(H,30,31)/t18-,19?,22-/m1/s1 |
| InChIKey | FBFNOKWBJGHOGZ-LROQTYINSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flavocillin (CHEBI:194484) has role antibacterial agent (CHEBI:33282) |
| flavocillin (CHEBI:194484) is a benzenes (CHEBI:22712) |
| flavocillin (CHEBI:194484) is a flavones (CHEBI:24043) |
| flavocillin (CHEBI:194484) is a penicillin (CHEBI:17334) |
| flavocillin (CHEBI:194484) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (5R,6R)-3,3-dimethyl-7-oxo-6-[3-(4-oxo-4H-chromen-2-yl)benzamido]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| Synonym | Source |
|---|---|
| (5R,6R)-3,3-dimethyl-7-oxo-6-[3-(4-oxo-4H-1-benzopyran-2-yl)benzamido]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| WO2019155266 | Patent |