EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N2O2 |
| Net Charge | 0 |
| Average Mass | 146.190 |
| Monoisotopic Mass | 146.10553 |
| SMILES | N[C@@H](CCCC[NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/t5-/m0/s1 |
| InChIKey | KDXKERNSBIXSRK-YFKPBYRVSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-Lysine zwitterion (CHEBI:194466) is a organic molecular entity (CHEBI:50860) |
| L-Lysine zwitterion (CHEBI:194466) is conjugate acid of L-lysinate (CHEBI:32550) |
| L-Lysine zwitterion (CHEBI:194466) is conjugate base of L-lysinium(1+) (CHEBI:32551) |
| L-Lysine zwitterion (CHEBI:194466) is tautomer of L-lysine (CHEBI:18019) |
| L-Lysine zwitterion (CHEBI:194466) is tautomer of L-lysine zwitterion (CHEBI:133538) |
| Incoming Relation(s) |
| L-lysinium(1+) (CHEBI:32551) is conjugate acid of L-Lysine zwitterion (CHEBI:194466) |
| L-lysinate (CHEBI:32550) is conjugate base of L-Lysine zwitterion (CHEBI:194466) |
| L-lysine (CHEBI:18019) is tautomer of L-Lysine zwitterion (CHEBI:194466) |
| L-lysine zwitterion (CHEBI:133538) is tautomer of L-Lysine zwitterion (CHEBI:194466) |