EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O2 |
| Net Charge | 0 |
| Average Mass | 282.468 |
| Monoisotopic Mass | 282.25588 |
| SMILES | CCCCCCC/C=C/CCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h8-9H,2-7,10-17H2,1H3,(H,19,20)/b9-8+ |
| InChIKey | QXJSBBXBKPUZAA-CMDGGOBGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (10E)-octadecenoic acid (CHEBI:194454) has role plant metabolite (CHEBI:76924) |
| (10E)-octadecenoic acid (CHEBI:194454) is a octadecenoic acid (CHEBI:25634) |
| (10E)-octadecenoic acid (CHEBI:194454) is conjugate acid of (10E)-octadecenoate (CHEBI:194438) |
| Incoming Relation(s) |
| (10E)-octadecenoate (CHEBI:194438) is conjugate base of (10E)-octadecenoic acid (CHEBI:194454) |
| IUPAC Name |
|---|
| (10E)-octadec-10-enoic acid |
| Synonyms | Source |
|---|---|
| (10E)-10-octadecenoic acid | ChEBI |
| 10E-octadecenoic acid | LIPID MAPS |
| (E)-10-octadecenoic acid | ChEBI |
| (E)-octadec-10-enoic acid | ChEBI |
| isooleic acid | KNApSAcK |
| trans-10-octadecenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00050972 | KNApSAcK |
| FDB004051 | FooDB |
| HMDB0302289 | HMDB |
| LMFA01030075 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:5684-82-2 | KNApSAcK |
| Citations |
|---|