EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12NO3S |
| Net Charge | -1 |
| Average Mass | 238.288 |
| Monoisotopic Mass | 238.05434 |
| SMILES | CC(=O)N[C@@H](CSc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C11H13NO3S/c1-8(13)12-10(11(14)15)7-16-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,12,13)(H,14,15)/p-1/t10-/m0/s1 |
| InChIKey | CICOZWHZVMOPJS-JTQLQIEISA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-S-phenyl-L-cysteine(1−) (CHEBI:194372) is a S-substituted N-acetyl-L-cysteinate (CHEBI:58718) |
| N-acetyl-S-phenyl-L-cysteine(1−) (CHEBI:194372) is conjugate base of N-acetyl-S-phenyl-L-cysteine (CHEBI:165887) |
| Incoming Relation(s) |
| N-acetyl-S-phenyl-L-cysteine (CHEBI:165887) is conjugate acid of N-acetyl-S-phenyl-L-cysteine(1−) (CHEBI:194372) |
| IUPAC Name |
|---|
| (2R)-2-acetamido-3-(phenylsulfanyl)propanoate |
| Synonyms | Source |
|---|---|
| N-acetyl-S-phenyl-L-cysteine anion | ChEBI |
| S-phenylmercapturate | ChEBI |
| phenylmercapturate | ChEBI |
| (R)-2-acetamido-3-(phenylthio)propanoate | ChEBI |