EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13NO3S |
| Net Charge | 0 |
| Average Mass | 239.296 |
| Monoisotopic Mass | 239.06161 |
| SMILES | CC(=O)N[C@@H](CSc1ccccc1)C(=O)O |
| InChI | InChI=1S/C11H13NO3S/c1-8(13)12-10(11(14)15)7-16-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,12,13)(H,14,15)/t10-/m0/s1 |
| InChIKey | CICOZWHZVMOPJS-JTQLQIEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | Urine (NCIT:C13283) | PubMed (32203622) |
| Roles Classification |
|---|
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-S-phenyl-L-cysteine (CHEBI:165887) has role biomarker (CHEBI:59163) |
| N-acetyl-S-phenyl-L-cysteine (CHEBI:165887) has role human urinary metabolite (CHEBI:84087) |
| N-acetyl-S-phenyl-L-cysteine (CHEBI:165887) is a S-substituted N-acetyl-L-cysteine (CHEBI:47911) |
| N-acetyl-S-phenyl-L-cysteine (CHEBI:165887) is a aryl sulfide (CHEBI:35683) |
| N-acetyl-S-phenyl-L-cysteine (CHEBI:165887) is conjugate acid of N-acetyl-S-phenyl-L-cysteine(1−) (CHEBI:194372) |
| Incoming Relation(s) |
| N-acetyl-S-phenyl-L-cysteine(1−) (CHEBI:194372) is conjugate base of N-acetyl-S-phenyl-L-cysteine (CHEBI:165887) |
| IUPAC Name |
|---|
| N-acetyl-S-phenyl-L-cysteine |
| Synonyms | Source |
|---|---|
| (2R)-2-acetamido-3-phenylsulfanylpropanoic acid | ChEBI |
| (2R)-2-acetamido-3-(phenylsulfanyl)propanoic acid | IUPAC |
| N-acetyl-3-(phenylthio)alanine | ChEBI |
| S-phenylmercapturic acid | ChEBI |
| S-PMA | ChEBI |
| (R)-2-acetamido-3-(phenylthio)propanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2005928 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:4775-80-8 | ChEBI |
| Citations |
|---|