EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO3S |
| Net Charge | 0 |
| Average Mass | 177.225 |
| Monoisotopic Mass | 177.04596 |
| SMILES | CSC[C@H](NC(C)=O)C(=O)O |
| InChI | InChI=1S/C6H11NO3S/c1-4(8)7-5(3-11-2)6(9)10/h5H,3H2,1-2H3,(H,7,8)(H,9,10)/t5-/m0/s1 |
| InChIKey | RYGLCORNOFFGTB-YFKPBYRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | Urine (NCIT:C13283) | PubMed (21110385) |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-S-methyl-L-cysteine (CHEBI:194359) has role human urinary metabolite (CHEBI:84087) |
| N-acetyl-S-methyl-L-cysteine (CHEBI:194359) has role human xenobiotic metabolite (CHEBI:76967) |
| N-acetyl-S-methyl-L-cysteine (CHEBI:194359) is a S-substituted N-acetyl-L-cysteine (CHEBI:47911) |
| N-acetyl-S-methyl-L-cysteine (CHEBI:194359) is a methyl sulfide (CHEBI:86315) |
| N-acetyl-S-methyl-L-cysteine (CHEBI:194359) is conjugate acid of N-acetyl-S-methyl-L-cysteine(1−) (CHEBI:194347) |
| Incoming Relation(s) |
| N-acetyl-S-methyl-L-cysteine(1−) (CHEBI:194347) is conjugate base of N-acetyl-S-methyl-L-cysteine (CHEBI:194359) |
| IUPAC Name |
|---|
| N-acetyl-S-methyl-L-cysteine |
| Synonyms | Source |
|---|---|
| (2R)-2-acetamido-3-methylsulfanylpropanoic acid | ChEBI |
| (2R)-2-acetamido-3-(methylsulfanyl)propanoic acid | IUPAC |
| S-methylmercapturic acid | ChEBI |
| (R)-2-acetamido-3-(methylthio)propanoic acid | ChEBI |
| (R)-2-(acetylamino)-3-(methylthio)propionic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0240544 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:16637-59-5 | ChEBI |
| Citations |
|---|