EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10NO3S |
| Net Charge | -1 |
| Average Mass | 176.217 |
| Monoisotopic Mass | 176.03869 |
| SMILES | CSC[C@H](NC(C)=O)C(=O)[O-] |
| InChI | InChI=1S/C6H11NO3S/c1-4(8)7-5(3-11-2)6(9)10/h5H,3H2,1-2H3,(H,7,8)(H,9,10)/p-1/t5-/m0/s1 |
| InChIKey | RYGLCORNOFFGTB-YFKPBYRVSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-S-methyl-L-cysteine(1−) (CHEBI:194347) is a S-substituted N-acetyl-L-cysteinate (CHEBI:58718) |
| N-acetyl-S-methyl-L-cysteine(1−) (CHEBI:194347) is conjugate base of N-acetyl-S-methyl-L-cysteine (CHEBI:194359) |
| Incoming Relation(s) |
| N-acetyl-S-methyl-L-cysteine (CHEBI:194359) is conjugate acid of N-acetyl-S-methyl-L-cysteine(1−) (CHEBI:194347) |
| IUPAC Name |
|---|
| (2R)-2-acetamido-3-(methylsulfanyl)propanoate |
| Synonyms | Source |
|---|---|
| (2R)-2-acetamido-3-methylsulfanylpropanoate | ChEBI |
| N-acetyl-S-methyl-L-cysteine anion | ChEBI |
| S-methylmercapturate | ChEBI |
| UniProt Name | Source |
|---|---|
| N-acetyl-S-methyl-L-cysteine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-26168 | MetaCyc |
| Citations |
|---|