EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O4 |
| Net Charge | 0 |
| Average Mass | 362.510 |
| Monoisotopic Mass | 362.24571 |
| SMILES | [H][C@]12C[C@@H](OC(C)=O)C(CO)=C[C@H](O)[C@]1(C)CC[C@@]1(C)CCC(C(C)C)=C12 |
| InChI | InChI=1S/C22H34O4/c1-13(2)16-6-7-21(4)8-9-22(5)17(20(16)21)11-18(26-14(3)24)15(12-23)10-19(22)25/h10,13,17-19,23,25H,6-9,11-12H2,1-5H3/t17-,18-,19+,21-,22-/m1/s1 |
| InChIKey | AOIDBNSVSJUUHH-PXIKZMAHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyathus africanus (ncbitaxon:380649) | - | PubMed (23075884) | |
| Cyathus earlei (ncbitaxon:1983729) | - | DOI (10.1139/v79-543) | |
| Hericium erinaceus (ncbitaxon:91752) | - | PubMed (15322365) | Strain: YB4-6237 |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-O-acetylcyathatriol (CHEBI:194354) has functional parent cyathatriol (CHEBI:194349) |
| 11-O-acetylcyathatriol (CHEBI:194354) has role anti-inflammatory agent (CHEBI:67079) |
| 11-O-acetylcyathatriol (CHEBI:194354) has role fungal metabolite (CHEBI:76946) |
| 11-O-acetylcyathatriol (CHEBI:194354) is a acetate ester (CHEBI:47622) |
| 11-O-acetylcyathatriol (CHEBI:194354) is a carbotricyclic compound (CHEBI:38032) |
| 11-O-acetylcyathatriol (CHEBI:194354) is a diol (CHEBI:23824) |
| 11-O-acetylcyathatriol (CHEBI:194354) is a polycyclic olefin (CHEBI:35714) |
| 11-O-acetylcyathatriol (CHEBI:194354) is a primary allylic alcohol (CHEBI:134394) |
| 11-O-acetylcyathatriol (CHEBI:194354) is a secondary allylic alcohol (CHEBI:134396) |
| 11-O-acetylcyathatriol (CHEBI:194354) is a tricyclic diterpenoid (CHEBI:79084) |
| IUPAC Name |
|---|
| (3aR,5aR,6S,9R,10aR)-6-hydroxy-8-(hydroxymethyl)-3a,5a-dimethyl-1-(propan-2-yl)-2,3,3a,4,5,5a,6,9,10,10a-decahydrocyclohepta[e]inden-9-yl acetate |
| Synonym | Source |
|---|---|
| (3aR)-1-isopropyl-3aβ,5aα-dimethyl-8-(hydroxymethyl)-9α-acetoxy-2,3,3a,4,5,5a,6,9,10,10aβ-decahydrocyclohepta[e]indene | ChEBI |
| UniProt Name | Source |
|---|---|
| 11-O-acetylcyathatriol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-26041 | MetaCyc |
| Citations |
|---|