EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O3 |
| Net Charge | 0 |
| Average Mass | 320.473 |
| Monoisotopic Mass | 320.23514 |
| SMILES | [H][C@]12C[C@@H](O)C(CO)=C[C@H](O)[C@]1(C)CC[C@@]1(C)CCC(C(C)C)=C12 |
| InChI | InChI=1S/C20H32O3/c1-12(2)14-5-6-19(3)7-8-20(4)15(18(14)19)10-16(22)13(11-21)9-17(20)23/h9,12,15-17,21-23H,5-8,10-11H2,1-4H3/t15-,16-,17+,19-,20-/m1/s1 |
| InChIKey | YQGDZWWLYAMTAU-HPUSYDDDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyathus africanus (ncbitaxon:380649) | Brush Cell (NCIT:C32236) | PubMed (23075884) | |
| Cyathus earlei (ncbitaxon:1983729) | - | DOI (10.1139/v79-543) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyathatriol (CHEBI:194349) has role fungal metabolite (CHEBI:76946) |
| cyathatriol (CHEBI:194349) is a carbotricyclic compound (CHEBI:38032) |
| cyathatriol (CHEBI:194349) is a polycyclic olefin (CHEBI:35714) |
| cyathatriol (CHEBI:194349) is a primary allylic alcohol (CHEBI:134394) |
| cyathatriol (CHEBI:194349) is a secondary allylic alcohol (CHEBI:134396) |
| cyathatriol (CHEBI:194349) is a tricyclic diterpenoid (CHEBI:79084) |
| cyathatriol (CHEBI:194349) is a triol (CHEBI:27136) |
| Incoming Relation(s) |
| 11-O-acetylcyathatriol (CHEBI:194354) has functional parent cyathatriol (CHEBI:194349) |
| IUPAC Name |
|---|
| (3aR,5aR,6S,9R,10aR)-8-(hydroxymethyl)-3a,5a-dimethyl-1-(propan-2-yl)-2,3,3a,4,5,5a,6,9,10,10a-decahydrocyclohepta[e]indene-6,9-diol |
| UniProt Name | Source |
|---|---|
| cyathatriol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-26039 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:70116-99-3 | ChEBI |
| Citations |
|---|