EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H52O4 |
| Net Charge | 0 |
| Average Mass | 488.753 |
| Monoisotopic Mass | 488.38656 |
| SMILES | Cc1c(C)c2c(c(C)c1OCC(=O)O)CC[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O2 |
| InChI | InChI=1S/C31H52O4/c1-21(2)12-9-13-22(3)14-10-15-23(4)16-11-18-31(8)19-17-27-26(7)29(34-20-28(32)33)24(5)25(6)30(27)35-31/h21-23H,9-20H2,1-8H3,(H,32,33)/t22-,23-,31-/m1/s1 |
| InChIKey | LCFWOFKPFDWYLR-CEFNRUSXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-tocopheryloxyacetic acid (CHEBI:194185) has functional parent (R,R,R)-α-tocopherol (CHEBI:18145) |
| α-tocopheryloxyacetic acid (CHEBI:194185) has role antineoplastic agent (CHEBI:35610) |
| α-tocopheryloxyacetic acid (CHEBI:194185) has role apoptosis inducer (CHEBI:68495) |
| α-tocopheryloxyacetic acid (CHEBI:194185) has role autophagy inducer (CHEBI:138880) |
| α-tocopheryloxyacetic acid (CHEBI:194185) is a aromatic ether (CHEBI:35618) |
| α-tocopheryloxyacetic acid (CHEBI:194185) is a chromanes (CHEBI:23230) |
| α-tocopheryloxyacetic acid (CHEBI:194185) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| ({(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-chromen-6-yl}oxy)acetic acid |
| Synonyms | Source |
|---|---|
| α-TEA | ChEBI |
| alpha-tocopheryloxyacetic acid | ChEBI |
| ({(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-1-benzopyran-6-yl}oxy)acetic acid | IUPAC |
| 2,5,7,8-tetramethyl-2R-(4R,8R,12-trimethyltridecyl)chroman-6-yloxyacetic acid | ChEBI |
| RRR-α-tocopheryloxyacetic acid | ChEBI |
| (RRR)-α-tocopheryloxyacetic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0248242 | HMDB |
| 8089051 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:261929-52-6 | SUBMITTER |
| Citations |
|---|