EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42O10 |
| Net Charge | 0 |
| Average Mass | 562.656 |
| Monoisotopic Mass | 562.27780 |
| SMILES | [H][C@@]12C=C(C)C(=O)[C@@]1(O)[C@H](O)[C@@]1(CO)O[C@H]1[C@]1([H])[C@]2(O)[C@H](C)[C@@H](OC(=O)/C(C)=C/C)[C@@]2(OC(=O)[C@@H](C)CC)C(C)(C)[C@@]12[H] |
| InChI | InChI=1S/C30H42O10/c1-9-13(3)23(33)38-21-16(6)28(36)17-11-15(5)20(32)29(17,37)25(35)27(12-31)22(39-27)18(28)19-26(7,8)30(19,21)40-24(34)14(4)10-2/h9,11,14,16-19,21-22,25,31,35-37H,10,12H2,1-8H3/b13-9+/t14-,16+,17-,18+,19+,21+,22-,25+,27-,28-,29+,30+/m0/s1 |
| InChIKey | YLQZMOUMDYVSQR-FOWZUWBHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fontainea picrosperma (ncbitaxon:1319830) | fruit (BTO:0000486) | PubMed (25272271) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. protein kinase C agonist An agonist that selectively binds to and activates a protein kinase C receptor |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tigilanol tiglate (CHEBI:194146) has role antineoplastic agent (CHEBI:35610) |
| tigilanol tiglate (CHEBI:194146) has role plant metabolite (CHEBI:76924) |
| tigilanol tiglate (CHEBI:194146) has role protein kinase C agonist (CHEBI:64018) |
| tigilanol tiglate (CHEBI:194146) is a diester (CHEBI:51307) |
| tigilanol tiglate (CHEBI:194146) is a diterpenoid (CHEBI:23849) |
| tigilanol tiglate (CHEBI:194146) is a organic heteropentacyclic compound (CHEBI:38164) |
| tigilanol tiglate (CHEBI:194146) is a phorbol ester (CHEBI:37532) |
| IUPAC Name |
|---|
| (1aR,1bR,1cS,2aR,3S,3aS,6aS,6bR,7R,8R,8aS)-3,3a,6b-trihydroxy-2a-(hydroxymethyl)-1,1,5,7-tetramethyl-8a-{[(2S)-2-methylbutanoyl]oxy}-4-oxo-1a,1b,1c,2a,3,3a,4,6a,6b,7,8,8a-dodecahydro-1H-cyclopropa[5',6']benzo[1',2':7,8]azuleno[5,6-b]oxiren-8-yl (2E)-2-methylbut-2-enoate |
| Synonyms | Source |
|---|---|
| EBC 46 | ChEBI |
| EBC-46 | ChemIDplus |
| EBC46 | ChEBI |
| EBI-46 | ChemIDplus |
| TT | ChEBI |
| Brand Name | Source |
|---|---|
| Stelfonta | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 52084739 | ChemSpider |
| D11191 | KEGG DRUG |
| Tigilanol_tiglate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:943001-56-7 | ChemIDplus |
| Citations |
|---|