EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15O8 |
| Net Charge | -1 |
| Average Mass | 359.310 |
| Monoisotopic Mass | 359.07724 |
| SMILES | COc1cc(O)c2c(=O)c([O-])c(-c3cc(OC)c(O)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C18H16O8/c1-23-9-6-10(19)14-11(7-9)26-18(17(22)16(14)21)8-4-12(24-2)15(20)13(5-8)25-3/h4-7,19-20,22H,1-3H3/p-1 |
| InChIKey | JWXGGDYYTFLUNW-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,3',5'-O-trimethylmyricetin 3-olate (CHEBI:194069) is a flavonoid oxoanion (CHEBI:60038) |
| 7,3',5'-O-trimethylmyricetin 3-olate (CHEBI:194069) is conjugate base of 7,3',5'-trimethylmyricetin (CHEBI:146136) |
| Incoming Relation(s) |
| 7,3',5'-trimethylmyricetin (CHEBI:146136) is conjugate acid of 7,3',5'-O-trimethylmyricetin 3-olate (CHEBI:194069) |
| UniProt Name | Source |
|---|---|
| 7,3',5'-O-trimethylmyricetin | UniProt |
| Citations |
|---|