EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O8 |
| Net Charge | 0 |
| Average Mass | 360.318 |
| Monoisotopic Mass | 360.08452 |
| SMILES | COc1cc(O)c2c(=O)c(O)c(-c3cc(OC)c(O)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C18H16O8/c1-23-9-6-10(19)14-11(7-9)26-18(17(22)16(14)21)8-4-12(24-2)15(20)13(5-8)25-3/h4-7,19-20,22H,1-3H3 |
| InChIKey | JWXGGDYYTFLUNW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,3',5'-trimethylmyricetin (CHEBI:146136) has functional parent myricetin (CHEBI:18152) |
| 7,3',5'-trimethylmyricetin (CHEBI:146136) has role plant metabolite (CHEBI:76924) |
| 7,3',5'-trimethylmyricetin (CHEBI:146136) is a trihydroxyflavone (CHEBI:27116) |
| 7,3',5'-trimethylmyricetin (CHEBI:146136) is a trimethoxyflavone (CHEBI:27124) |
| 7,3',5'-trimethylmyricetin (CHEBI:146136) is conjugate acid of 7,3',5'-O-trimethylmyricetin 3-olate (CHEBI:194069) |
| Incoming Relation(s) |
| 7,3',5'-O-trimethylmyricetin 3-olate (CHEBI:194069) is conjugate base of 7,3',5'-trimethylmyricetin (CHEBI:146136) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-7-methoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3',5',7-trimethoxy-3,4',5-trihydroxyflavone | ChEBI |
| 3,5-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-7-methoxy-4H-1-benzopyran-4-one | IUPAC |
| 7,3',5'-trimethyl myricetin | ChEBI |
| myricetin 7,3',5'-trimethyl ether | MetaCyc |
| Citations |
|---|