EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H13O6 |
| Net Charge | -1 |
| Average Mass | 313.285 |
| Monoisotopic Mass | 313.07176 |
| SMILES | COc1ccc(-c2oc3cc(OC)cc(O)c3c(=O)c2[O-])cc1 |
| InChI | InChI=1S/C17H14O6/c1-21-10-5-3-9(4-6-10)17-16(20)15(19)14-12(18)7-11(22-2)8-13(14)23-17/h3-8,18,20H,1-2H3/p-1 |
| InChIKey | KZBAXKKOXPLOBX-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,4'-O-dimethylkaempferol 3-olate (CHEBI:194067) is a flavonoid oxoanion (CHEBI:60038) |
| 7,4'-O-dimethylkaempferol 3-olate (CHEBI:194067) is conjugate base of 7,4'-dimethylkaempferol (CHEBI:146145) |
| Incoming Relation(s) |
| 7,4'-dimethylkaempferol (CHEBI:146145) is conjugate acid of 7,4'-O-dimethylkaempferol 3-olate (CHEBI:194067) |
| UniProt Name | Source |
|---|---|
| 7,4'-O-dimethylkaempferol | UniProt |
| Citations |
|---|