EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O6 |
| Net Charge | 0 |
| Average Mass | 314.293 |
| Monoisotopic Mass | 314.07904 |
| SMILES | COc1ccc(-c2oc3cc(OC)cc(O)c3c(=O)c2O)cc1 |
| InChI | InChI=1S/C17H14O6/c1-21-10-5-3-9(4-6-10)17-16(20)15(19)14-12(18)7-11(22-2)8-13(14)23-17/h3-8,18,20H,1-2H3 |
| InChIKey | KZBAXKKOXPLOBX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alpinia flabellata (ncbitaxon:299923) | leaf (BTO:0000713) | PubMed (11198817) | |
| Betula exilis (IPNI:32130-2) | leaf (BTO:0000713) | DOI (/10.1007/BF00574275) | |
| Betula pendula (ncbitaxon:3505) | - | DOI (/10.1134/S1068162012070217) | |
| Hornstedtia havilandii (ncbitaxon:188512) | leaf (BTO:0000713) | PubMed (26594759) | |
| Propolis (ncbitaxon:931589) | - | DOI (/10.1007/BF00568574) | |
| Serratula strangulata (ncbitaxon:324596) | - | PubMed (12451496) | |
| Tamarix aphylla (ncbitaxon:189786) | aerial part (BTO:0001658) | PubMed (31640181) | |
| Zingiber mekongense (IPNI:873060-1) | rhizome (BTO:0001181) | PubMed (21238547) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,4'-dimethylkaempferol (CHEBI:146145) has functional parent kaempferol (CHEBI:28499) |
| 7,4'-dimethylkaempferol (CHEBI:146145) has role antioxidant (CHEBI:22586) |
| 7,4'-dimethylkaempferol (CHEBI:146145) has role plant metabolite (CHEBI:76924) |
| 7,4'-dimethylkaempferol (CHEBI:146145) is a dihydroxyflavone (CHEBI:38686) |
| 7,4'-dimethylkaempferol (CHEBI:146145) is a dimethoxyflavone (CHEBI:23798) |
| 7,4'-dimethylkaempferol (CHEBI:146145) is a flavonols (CHEBI:28802) |
| 7,4'-dimethylkaempferol (CHEBI:146145) is conjugate acid of 7,4'-O-dimethylkaempferol 3-olate (CHEBI:194067) |
| Incoming Relation(s) |
| 7,4'-O-dimethylkaempferol 3-olate (CHEBI:194067) is conjugate base of 7,4'-dimethylkaempferol (CHEBI:146145) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-7-methoxy-2-(4-methoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3,5-dihydroxy-4',7-dimethoxyflavone | ChEBI |
| 3,5-dihydroxy-7,4'-dimethoxyflavone | LIPID MAPS |
| 3,5-dihydroxy-7-methoxy-2-(4-methoxyphenyl)-4-benzopyrone | ChemIDplus |
| 3,5-dihydroxy-7-methoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one | IUPAC |
| 3,5-dihydroxy-7-methoxy-2-(4-methoxy-phenyl)-chromen-4-one | ChEBI |
| 4'-O,7-O-dimethylkaempferol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-14951 | MetaCyc |
| LMPK12112595 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:15486-33-6 | ChemIDplus |
| Citations |
|---|