EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5O4 |
| Net Charge | -1 |
| Average Mass | 141.102 |
| Monoisotopic Mass | 141.01933 |
| SMILES | O=C([O-])c1ccc(CO)o1 |
| InChI | InChI=1S/C6H6O4/c7-3-4-1-2-5(10-4)6(8)9/h1-2,7H,3H2,(H,8,9)/p-1 |
| InChIKey | PCSKKIUURRTAEM-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Hydroxymethyl-2-furanoate (CHEBI:193964) is a furoic acid (CHEBI:36055) |
| IUPAC Name |
|---|
| 5-(hydroxymethyl)uran-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 5319446 | ChemSpider |
| HMDB0029188 | HMDB |