EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O7 |
| Net Charge | 0 |
| Average Mass | 318.281 |
| Monoisotopic Mass | 318.07395 |
| SMILES | COc1cc([C@H]2Oc3cc(O)cc(O)c3C(=O)[C@@H]2O)ccc1O |
| InChI | InChI=1S/C16H14O7/c1-22-11-4-7(2-3-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,15-19,21H,1H3/t15-,16+/m0/s1 |
| InChIKey | JWYULKXTGMJKKM-JKSUJKDBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Beta vulgaris (ncbitaxon:161934) | Root (BTO:0001188) | PubMed (7765684) | |
| Dillenia indica (ncbitaxon:4378) | - | DOI (10.1039/P19750000612) | |
| Oryza sativa Japonica Group (ncbitaxon:39947) | - | DOI (10.1021/jf403072c) | |
| Pulicaria jaubertii (ncbitaxon:557693) | aerial part (BTO:0001658) | DOI (10.1080/14786419.2015.1055492) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-dihydroisorhamnetin (CHEBI:193530) has role plant metabolite (CHEBI:76924) |
| (+)-dihydroisorhamnetin (CHEBI:193530) is a dihydroisorhamnetin (CHEBI:175075) |
| IUPAC Name |
|---|
| (2R,3R)-3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| (2R,3R)-2,3-dihydro-3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-1-benzopyran-4-one | ChEBI |
| (2R,3R)-3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,3-dihydro-4H-1-benzopyran-4-one | IUPAC |
| (2R,3R)-3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,3-dihydrochromen-4-one | ChEBI |
| (2R-trans)-2,3-dihydro-3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-1-benzopyran-4-one | ChEBI |
| (+)-3,4',5,7-tetrahydroxy-3'-methoxyflavanone | ChEBI |
| (+)-3'-O-methyltaxifolin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00008579 | KNApSAcK |
| LMPK12140719 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:55812-91-4 | ChemIDplus |
| Citations |
|---|