EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O7 |
| Net Charge | 0 |
| Average Mass | 318.281 |
| Monoisotopic Mass | 318.07395 |
| SMILES | COc1cc(C2Oc3cc(O)cc(O)c3C(=O)C2O)ccc1O |
| InChI | InChI=1S/C16H14O7/c1-22-11-4-7(2-3-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,15-19,21H,1H3 |
| InChIKey | JWYULKXTGMJKKM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cephalostachyum fuchsianum (ncbitaxon:338484) | fruit (BTO:0000486) | PubMed (35744892) | |
| Lychnophora granmogolensis (ncbitaxon:1569411) | aerial part (BTO:0001658) | PubMed (10815016) | |
| Oryza sativa Japonica Group (ncbitaxon:39947) | - | PubMed (17147636) | |
| Rattus norvegicus (ncbitaxon:10116) | blood plasma (BTO:0000118) | PubMed (23217303) | |
| Suaeda japonica (ncbitaxon:90346) | - | DOI (10.1007/s10068-013-0250-2) |
| Roles Classification |
|---|
| Biological Roles: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydroisorhamnetin (CHEBI:175075) has functional parent taxifolin (CHEBI:38747) |
| dihydroisorhamnetin (CHEBI:175075) has role plant metabolite (CHEBI:76924) |
| dihydroisorhamnetin (CHEBI:175075) has role rat metabolite (CHEBI:86264) |
| dihydroisorhamnetin (CHEBI:175075) is a 3'-methoxyflavanones (CHEBI:140351) |
| dihydroisorhamnetin (CHEBI:175075) is a 4'-hydroxyflavanones (CHEBI:140331) |
| dihydroisorhamnetin (CHEBI:175075) is a dihydroflavonols (CHEBI:48039) |
| dihydroisorhamnetin (CHEBI:175075) is a monomethoxyflavanone (CHEBI:38738) |
| dihydroisorhamnetin (CHEBI:175075) is a secondary α-hydroxy ketone (CHEBI:2468) |
| dihydroisorhamnetin (CHEBI:175075) is a tetrahydroxyflavanone (CHEBI:38742) |
| Incoming Relation(s) |
| (+)-dihydroisorhamnetin (CHEBI:193530) is a dihydroisorhamnetin (CHEBI:175075) |
| IUPAC Name |
|---|
| 3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 2,3-dihydroisorhamnetin | ChEBI |
| 3,4',5,7-tetrahydroxy-3'-methoxyflavanone | ChEBI |
| 3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,3-dihydro-4H-1-benzopyran-4-one | IUPAC |
| 3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,3-dihydrochromen-4-one | ChEBI |
| 3'-O-methyl taxifolin | ChEBI |
| 3'-O-methyltaxifolin | ChEBI |
| UniProt Name | Source |
|---|---|
| taxifolin 3'-methyl ether | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 24958721 | ChemSpider |
| FDB016576 | FooDB |
| HMDB0037501 | HMDB |
| Citations |
|---|