EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6Cl2O5 |
| Net Charge | 0 |
| Average Mass | 229.015 |
| Monoisotopic Mass | 227.95923 |
| SMILES | O=C(O)CC(Cl)C(=O)C(Cl)C(=O)O |
| InChI | InChI=1S/C6H6Cl2O5/c7-2(1-3(9)10)5(11)4(8)6(12)13/h2,4H,1H2,(H,9,10)(H,12,13) |
| InChIKey | PWUASGXACKVWSY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dichloro-3-oxoadipic acid (CHEBI:177909) has functional parent adipic acid (CHEBI:30832) |
| 2,4-dichloro-3-oxoadipic acid (CHEBI:177909) is a chlorocarboxylic acid (CHEBI:36685) |
| 2,4-dichloro-3-oxoadipic acid (CHEBI:177909) is a oxo dicarboxylic acid (CHEBI:36145) |
| 2,4-dichloro-3-oxoadipic acid (CHEBI:177909) is conjugate acid of 2,4-dichloro-3-oxoadipate(2−) (CHEBI:19345) |
| Incoming Relation(s) |
| 2,4-dichloro-3-oxoadipate(2−) (CHEBI:19345) is conjugate base of 2,4-dichloro-3-oxoadipic acid (CHEBI:177909) |
| IUPAC Name |
|---|
| 2,4-dichloro-3-oxohexanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| C18244 | KEGG COMPOUND |
| Citations |
|---|