EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2 |
| Net Charge | 0 |
| Average Mass | 131.175 |
| Monoisotopic Mass | 131.09463 |
| SMILES | CC[C@@H](C)[C@@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m1/s1 |
| InChIKey | AGPKZVBTJJNPAG-RFZPGFLSSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-isoleucine zwitterion (CHEBI:193151) is a α-amino-acid zwitterion (CHEBI:78608) |
| D-isoleucine zwitterion (CHEBI:193151) is tautomer of D-isoleucine (CHEBI:27730) |
| Incoming Relation(s) |
| D-isoleucine (CHEBI:27730) is tautomer of D-isoleucine zwitterion (CHEBI:193151) |
| UniProt Name | Source |
|---|---|
| D-isoleucine | UniProt |
| Citations |
|---|