EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O5 |
| Net Charge | 0 |
| Average Mass | 300.310 |
| Monoisotopic Mass | 300.09977 |
| SMILES | COc1ccc([C@@H]2CC(=O)c3c(O)cc(OC)cc3O2)cc1 |
| InChI | InChI=1S/C17H16O5/c1-20-11-5-3-10(4-6-11)15-9-14(19)17-13(18)7-12(21-2)8-16(17)22-15/h3-8,15,18H,9H2,1-2H3/t15-/m0/s1 |
| InChIKey | CKEXCBVNKRHAMX-HNNXBMFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cryptocarya obovata (ncbitaxon:29743) | - | DOI (10.1016/j.bmcl.2010.05.091) | |
| Pogostemon cablin (ncbitaxon:28511) | aerial part (BTO:0001658) | DOI (10.1002/hlca.201000151) | |
| Renealmia alpinia (ncbitaxon:199658) | aerial part (BTO:0001658) | PubMed (25686780) | |
| Sarcandra hainanensis (ncbitaxon:146545) | whole plant (BTO:0001461) | DOI (10.1248/cpb.58.1395) | |
| Vitex quinata (ncbitaxon:167923) | leaf (BTO:0000713) | DOI (10.1016/j.phytol.2011.03.007) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-5-hydroxy-4',7-dimethoxyflavanone (CHEBI:192816) has functional parent (S)-naringenin (CHEBI:17846) |
| (2S)-5-hydroxy-4',7-dimethoxyflavanone (CHEBI:192816) is a (2S)-flavan-4-one (CHEBI:140377) |
| (2S)-5-hydroxy-4',7-dimethoxyflavanone (CHEBI:192816) is a 5-hydroxy-4',7-dimethoxyflavanone (CHEBI:157737) |
| IUPAC Name |
|---|
| (2S)-5-hydroxy-7-methoxy-2-(4-methoxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| (2S)-4',7-di-O-methylnaringenin | ChEBI |
| (2S)-4',7-dimethoxy-5-hydroxyflavanone | ChEBI |
| (2S)-5-hydroxy-7-methoxy-2-(4-methoxyphenyl)-2,3-dihydro-4H-1-benzopyran-4-one | IUPAC |
| (2S)-5-hydroxy-7-methoxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one | ChEBI |
| (2S)-naringenin 4',7-dimethyl ether | ChEBI |
| (−)-5-hydroxy-4',7-dimethoxyflavanone | ChEBI |
| UniProt Name | Source |
|---|---|
| (2S)-naringenin 4',7-dimethyl ether | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:29424-96-2 | PubChem Compound |
| Citations |
|---|