EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O5 |
| Net Charge | 0 |
| Average Mass | 300.310 |
| Monoisotopic Mass | 300.09977 |
| SMILES | COc1ccc(C2CC(=O)c3c(O)cc(OC)cc3O2)cc1 |
| InChI | InChI=1S/C17H16O5/c1-20-11-5-3-10(4-6-11)15-9-14(19)17-13(18)7-12(21-2)8-16(17)22-15/h3-8,15,18H,9H2,1-2H3 |
| InChIKey | CKEXCBVNKRHAMX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper methysticum (ncbitaxon:130404) | |||
| stem (BTO:0001300) | MetaboLights (MTBLS1485) | Strain: Piper methysticum cv. Loa Kasa Leka | |
| crown root (PO:0000043) | MetaboLights (MTBLS1485) | Strain: Piper methysticum cv. Loa Kasa Leka | |
| lateral root (BTO:0005441) | MetaboLights (MTBLS1485) | Strain: Piper methysticum cv. Loa Kasa Leka | |
| Root (BTO:0001188) | PubMed (36496697) | ||
| Murraya euchrestifolia (ncbitaxon:1224773) | - | PubMed (29090551) | |
| Artemisia sphaerocephala (ncbitaxon:401934) | - | PubMed (22737859) | |
| Artemisia ordosica (ncbitaxon:1027791) | - | PubMed (16381463) | |
| Chromolaena odorata (ncbitaxon:103745) | leaf (BTO:0000713) | PubMed (22899281) | |
| Miliusa sinensis (IPNI:73952-1) | - | PubMed (21859261) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxy-4',7-dimethoxyflavanone (CHEBI:157737) has functional parent naringenin (CHEBI:50202) |
| 5-hydroxy-4',7-dimethoxyflavanone (CHEBI:157737) has role plant growth retardant (CHEBI:35219) |
| 5-hydroxy-4',7-dimethoxyflavanone (CHEBI:157737) has role plant metabolite (CHEBI:76924) |
| 5-hydroxy-4',7-dimethoxyflavanone (CHEBI:157737) is a 4'-methoxyflavanones (CHEBI:140332) |
| 5-hydroxy-4',7-dimethoxyflavanone (CHEBI:157737) is a dimethoxyflavanone (CHEBI:38743) |
| 5-hydroxy-4',7-dimethoxyflavanone (CHEBI:157737) is a monohydroxyflavanone (CHEBI:38748) |
| Incoming Relation(s) |
| (2S)-5-hydroxy-4',7-dimethoxyflavanone (CHEBI:192816) is a 5-hydroxy-4',7-dimethoxyflavanone (CHEBI:157737) |
| IUPAC Name |
|---|
| 5-hydroxy-7-methoxy-2-(4-methoxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 5-hydroxy-7-methoxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one | ChEBI |
| 5-hydroxy-7-methoxy-2-(4-methoxyphenyl)-2,3-dihydro-4H-1-benzopyran-4-one | IUPAC |
| naringenin 7,4'-dimethyl ether | LIPID MAPS |
| 7,4'-dimethoxy-5-hydroxyflavanone | ChEBI |
| 5-hydroxy-2,3-dihydro-7-methoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one | ChEBI |
| 5-hydroxy-7,4'-dimethoxyflavanone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 284452 | ChemSpider |
| LMPK12140574 | LIPID MAPS |
| Citations |
|---|