EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22N2O5 |
| Net Charge | 0 |
| Average Mass | 394.427 |
| Monoisotopic Mass | 394.15287 |
| SMILES | CCc1c(C(=O)C(N)=O)c2c(OCC(=O)OC)cccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C22H22N2O5/c1-3-15-20(21(26)22(23)27)19-16(24(15)12-14-8-5-4-6-9-14)10-7-11-17(19)29-13-18(25)28-2/h4-11H,3,12-13H2,1-2H3,(H2,23,27) |
| InChIKey | VJYDOJXJUCJUHL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.4 (phospholipase A2) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of phospholipase A2 (EC 3.1.1.4). |
| Applications: | antidote Any protective agent counteracting or neutralizing the action of poisons. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| varespladib methyl (CHEBI:192805) has functional parent varespladib (CHEBI:189668) |
| varespladib methyl (CHEBI:192805) has role anti-inflammatory drug (CHEBI:35472) |
| varespladib methyl (CHEBI:192805) has role antidote (CHEBI:50247) |
| varespladib methyl (CHEBI:192805) has role EC 3.1.1.4 (phospholipase A2) inhibitor (CHEBI:50469) |
| varespladib methyl (CHEBI:192805) has role prodrug (CHEBI:50266) |
| varespladib methyl (CHEBI:192805) is a aromatic ether (CHEBI:35618) |
| varespladib methyl (CHEBI:192805) is a benzenes (CHEBI:22712) |
| varespladib methyl (CHEBI:192805) is a indoles (CHEBI:24828) |
| varespladib methyl (CHEBI:192805) is a methyl ester (CHEBI:25248) |
| varespladib methyl (CHEBI:192805) is a primary carboxamide (CHEBI:140324) |
| IUPAC Name |
|---|
| methyl ({3-[amino(oxo)acetyl]-1-benzyl-2-ethyl-1H-indol-4-yl}oxy)acetate |
| Synonyms | Source |
|---|---|
| A-002 | ChemIDplus |
| LY 333013 | ChemIDplus |
| LY-333013 | ChemIDplus |
| LY333013 | ChemIDplus |
| methyl varespladib | ChEBI |
| methyl-varespladib | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8062590 | ChemSpider |
| D08221 | KEGG DRUG |
| DB05737 | DrugBank |
| HMDB0259767 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:172733-08-3 | ChemIDplus |
| Citations |
|---|