EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20N2O5 |
| Net Charge | 0 |
| Average Mass | 380.400 |
| Monoisotopic Mass | 380.13722 |
| SMILES | CCc1c(C(=O)C(N)=O)c2c(OCC(=O)O)cccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C21H20N2O5/c1-2-14-19(20(26)21(22)27)18-15(9-6-10-16(18)28-12-17(24)25)23(14)11-13-7-4-3-5-8-13/h3-10H,2,11-12H2,1H3,(H2,22,27)(H,24,25) |
| InChIKey | BHLXTPHDSZUFHR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 3.1.1.4 (phospholipase A2) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of phospholipase A2 (EC 3.1.1.4). |
| Applications: | antidote Any protective agent counteracting or neutralizing the action of poisons. anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| varespladib (CHEBI:189668) has role anti-inflammatory drug (CHEBI:35472) |
| varespladib (CHEBI:189668) has role antidote (CHEBI:50247) |
| varespladib (CHEBI:189668) has role EC 3.1.1.4 (phospholipase A2) inhibitor (CHEBI:50469) |
| varespladib (CHEBI:189668) is a aromatic ether (CHEBI:35618) |
| varespladib (CHEBI:189668) is a benzenes (CHEBI:22712) |
| varespladib (CHEBI:189668) is a dicarboxylic acid monoamide (CHEBI:35735) |
| varespladib (CHEBI:189668) is a indoles (CHEBI:24828) |
| varespladib (CHEBI:189668) is a monocarboxylic acid (CHEBI:25384) |
| varespladib (CHEBI:189668) is a primary carboxamide (CHEBI:140324) |
| varespladib (CHEBI:189668) is conjugate acid of varespladib(1−) (CHEBI:189666) |
| Incoming Relation(s) |
| varespladib methyl (CHEBI:192805) has functional parent varespladib (CHEBI:189668) |
| varespladib(1−) (CHEBI:189666) is conjugate base of varespladib (CHEBI:189668) |
| IUPAC Name |
|---|
| ({3-[amino(oxo)acetyl]-1-benzyl-2-ethyl-1H-indol-4-yl}oxy)acetic acid |
| INNs | Source |
|---|---|
| varespladib | WHO MedNet |
| varespladib | WHO MedNet |
| varespladib | WHO MedNet |
| varespladibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-[2-ethyl-3-oxamoyl-1-(phenylmethyl)indol-4-yl]oxyethanoic acid | PDBeChem |
| 2-[[3-(2-Amino-2-oxoacetyl)-2-ethyl-1-(phenylmethyl)-1H-indol-4-yl]oxy]acetic acid | ChEBI |
| A-001 | ChEBI |
| LY 315920 | ChEBI |
| LY-315920 | ChEBI |
| LY315920 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 137248 | ChemSpider |
| CN101838232 | Patent |
| D08107 | KEGG DRUG |
| DB11909 | DrugBank |
| HMDB0259766 | HMDB |
| Varespladib | Wikipedia |
| VRD | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:172732-68-2 | ChemIDplus |
| Citations |
|---|