EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O4 |
| Net Charge | 0 |
| Average Mass | 282.295 |
| Monoisotopic Mass | 282.08921 |
| SMILES | COc1ccc2c(=O)cc(-c3ccccc3)oc2c1OC |
| InChI | InChI=1S/C17H14O4/c1-19-14-9-8-12-13(18)10-15(11-6-4-3-5-7-11)21-16(12)17(14)20-2/h3-10H,1-2H3 |
| InChIKey | KJRQQECDVUXBCO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aizoon africanum (ncbitaxon:215966) | - | PubMed (20133976) | Species also known as Galenia africana. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,8-dimethoxyflavone (CHEBI:192767) has functional parent 7,8-dihydroxyflavone (CHEBI:140464) |
| 7,8-dimethoxyflavone (CHEBI:192767) has role anti-inflammatory agent (CHEBI:67079) |
| 7,8-dimethoxyflavone (CHEBI:192767) has role plant metabolite (CHEBI:76924) |
| 7,8-dimethoxyflavone (CHEBI:192767) is a dimethoxyflavone (CHEBI:23798) |
| IUPAC Name |
|---|
| 7,8-dimethoxy-2-phenyl-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 7,8-dimethoxy-2-phenyl-4H-1-benzopyran-4-one | IUPAC |
| 7,8-dimethoxy-2-phenylchromen-4-one | ChEBI |
| 7,8-dimethoxy-flavone | MetaCyc |
| UniProt Name | Source |
|---|---|
| 7,8-dimethoxyflavone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00013292 | KNApSAcK |
| CPD-15485 | MetaCyc |
| LMPK12110074 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:65548-54-1 | ChEBI |
| Citations |
|---|