EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O4 |
| Net Charge | 0 |
| Average Mass | 254.241 |
| Monoisotopic Mass | 254.05791 |
| SMILES | O=c1cc(-c2ccccc2)oc2c(O)c(O)ccc12 |
| InChI | InChI=1S/C15H10O4/c16-11-7-6-10-12(17)8-13(19-15(10)14(11)18)9-4-2-1-3-5-9/h1-8,16,18H |
| InChIKey | COCYGNDCWFKTMF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lepisorus ussuriensis (ncbitaxon:699700) | whole plant (BTO:0001461) | PubMed (26569039) | |
| Primula halleri (ncbitaxon:175072) | leaf (BTO:0000713) | PubMed (24345641) | |
| Tridax procumbens (ncbitaxon:318066) | - | Article (Int. J. Med. Arom. Plants, 2012, 2, 185-194.) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | tropomyosin-related kinase B receptor agonist An agonist that binds to and deactivates the tropomyosin-related kinase B (TrkB) receptor, the main signaling receptor of the neurotrophin brain-derived neurotrophic factor (BDNF). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,8-dihydroxyflavone (CHEBI:140464) has role antidepressant (CHEBI:35469) |
| 7,8-dihydroxyflavone (CHEBI:140464) has role antineoplastic agent (CHEBI:35610) |
| 7,8-dihydroxyflavone (CHEBI:140464) has role antioxidant (CHEBI:22586) |
| 7,8-dihydroxyflavone (CHEBI:140464) has role plant metabolite (CHEBI:76924) |
| 7,8-dihydroxyflavone (CHEBI:140464) has role tropomyosin-related kinase B receptor agonist (CHEBI:140489) |
| 7,8-dihydroxyflavone (CHEBI:140464) is a dihydroxyflavone (CHEBI:38686) |
| Incoming Relation(s) |
| 7,8-dimethoxyflavone (CHEBI:192767) has functional parent 7,8-dihydroxyflavone (CHEBI:140464) |
| IUPAC Name |
|---|
| 7,8-dihydroxy-2-phenyl-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 7,8-DHF | SUBMITTER |
| 7,8-dihydroxy-2-phenyl-4-benzopyrone | ChemIDplus |
| 7,8-dihydroxy-2-phenylchromone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 329798806 | PubChem Compound |
| 7,8-Dihydroxyflavone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:234350 | Reaxys |
| CAS:38183-03-8 | ChemIDplus |
| Citations |
|---|