EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H11O6 |
| Net Charge | -1 |
| Average Mass | 299.258 |
| Monoisotopic Mass | 299.05611 |
| SMILES | COc1cc([O-])c2c(=O)cc(-c3ccc(O)c(O)c3)oc2c1 |
| InChI | InChI=1S/C16H12O6/c1-21-9-5-12(19)16-13(20)7-14(22-15(16)6-9)8-2-3-10(17)11(18)4-8/h2-7,17-19H,1H3/p-1 |
| InChIKey | RRRSSAVLTCVNIQ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| luteolin-5-olate 7-methyl ether (CHEBI:192705) is a flavonoid oxoanion (CHEBI:60038) |
| luteolin-5-olate 7-methyl ether (CHEBI:192705) is conjugate base of Luteolin 7-methyl ether (CHEBI:168675) |
| Incoming Relation(s) |
| Luteolin 7-methyl ether (CHEBI:168675) is conjugate acid of luteolin-5-olate 7-methyl ether (CHEBI:192705) |
| UniProt Name | Source |
|---|---|
| luteolin 7-methyl ether | UniProt |
| Citations |
|---|